Dataset Viewer
Question
stringlengths 471
531
| Answer
stringlengths 19
34
| TargetMolecule
stringlengths 2
62
| SampleMethod
stringclasses 1
value | SampleNum
int64 0
0
| SampleRep
stringclasses 1
value | image
imagewidth (px) 300
300
|
|---|---|---|---|---|---|---|
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Cc1[nH]c(=O)n(c(=O)c1Cl)C(C)(C)C
Log Solubility:
|
<float>-2.484</float>
|
Cc1[nH]c(=O)n(c(=O)c1Cl)C(C)(C)C
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCOP(=S)(OCC)SCCSCC
Log Solubility:
|
<float>-4.23</float>
|
CCOP(=S)(OCC)SCCSCC
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCN2c1cc(N(C)C)cc(C)c1NC(=O)c3cccnc23
Log Solubility:
|
<float>-4.871</float>
|
CCN2c1cc(N(C)C)cc(C)c1NC(=O)c3cccnc23
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CC(C)c1ccc(C)cc1O
Log Solubility:
|
<float>-2.22</float>
|
CC(C)c1ccc(C)cc1O
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Fc1cccc(F)c1C(=O)NC(=O)Nc2ccc(Cl)cc2
Log Solubility:
|
<float>-6.02</float>
|
Fc1cccc(F)c1C(=O)NC(=O)Nc2ccc(Cl)cc2
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): ClC(Cl)C(Cl)(Cl)Cl
Log Solubility:
|
<float>-2.6</float>
|
ClC(Cl)C(Cl)(Cl)Cl
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): ClC(Cl)=C(c1ccc(Cl)cc1)c2ccc(Cl)cc2
Log Solubility:
|
<float>-6.9</float>
|
ClC(Cl)=C(c1ccc(Cl)cc1)c2ccc(Cl)cc2
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): C1c2ccccc2c3ccc4ccccc4c13
Log Solubility:
|
<float>-6.68</float>
|
C1c2ccccc2c3ccc4ccccc4c13
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): NS(=O)(=O)c2cc1c(NCNS1(=O)=O)cc2Cl
Log Solubility:
|
<float>-2.63</float>
|
NS(=O)(=O)c2cc1c(NCNS1(=O)=O)cc2Cl
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCCC(O)CC
Log Solubility:
|
<float>-0.8</float>
|
CCCC(O)CC
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCCCC(=O)C
Log Solubility:
|
<float>-0.8</float>
|
CCCCC(=O)C
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Oc1ccc(O)cc1
Log Solubility:
|
<float>-0.17</float>
|
Oc1ccc(O)cc1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CNC(=O)Oc1cccc(N=CN(C)C)c1
Log Solubility:
|
<float>-2.34</float>
|
CNC(=O)Oc1cccc(N=CN(C)C)c1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCC=O
Log Solubility:
|
<float>0.58</float>
|
CCC=O
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCOC(=O)c1ccc(N)cc1
Log Solubility:
|
<float>-2.616</float>
|
CCOC(=O)c1ccc(N)cc1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): NS(=O)(=O)c2cc1c(NCNS1(=O)=O)cc2Cl
Log Solubility:
|
<float>-2.63</float>
|
NS(=O)(=O)c2cc1c(NCNS1(=O)=O)cc2Cl
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Cc1cc(cc(N(=O)=O)c1O)N(=O)=O
Log Solubility:
|
<float>-1.456</float>
|
Cc1cc(cc(N(=O)=O)c1O)N(=O)=O
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCNc1nc(Cl)nc(NC(C)C)n1
Log Solubility:
|
<float>-3.85</float>
|
CCNc1nc(Cl)nc(NC(C)C)n1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Cn1cnc2n(C)c(=O)n(C)c(=O)c12
Log Solubility:
|
<float>-0.8759999999999999</float>
|
Cn1cnc2n(C)c(=O)n(C)c(=O)c12
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Sc1nccc(=O)[nH]1
Log Solubility:
|
<float>-2.273</float>
|
Sc1nccc(=O)[nH]1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Sc2nc1ccccc1s2
Log Solubility:
|
<float>-3.18</float>
|
Sc2nc1ccccc1s2
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCN2c1ncccc1N(C)C(=S)c3cccnc23
Log Solubility:
|
<float>-4.634</float>
|
CCN2c1ncccc1N(C)C(=S)c3cccnc23
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Clc1cc(Cl)c(cc1Cl)c2cccc(Cl)c2Cl
Log Solubility:
|
<float>-7.21</float>
|
Clc1cc(Cl)c(cc1Cl)c2cccc(Cl)c2Cl
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCN(CC)c1nc(Cl)nc(NC(C)C)n1
Log Solubility:
|
<float>-3.785</float>
|
CCN(CC)c1nc(Cl)nc(NC(C)C)n1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCCCCCCC=C
Log Solubility:
|
<float>-5.05</float>
|
CCCCCCCC=C
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CNC(=O)Oc1cccc(N=CN(C)C)c1
Log Solubility:
|
<float>-2.34</float>
|
CNC(=O)Oc1cccc(N=CN(C)C)c1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CC(C)OC(=O)C
Log Solubility:
|
<float>-0.55</float>
|
CC(C)OC(=O)C
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Cc1cccc(N)c1
Log Solubility:
|
<float>-0.85</float>
|
Cc1cccc(N)c1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCOC2Oc1ccc(OS(C)(=O)=O)cc1C2(C)C
Log Solubility:
|
<float>-3.42</float>
|
CCOC2Oc1ccc(OS(C)(=O)=O)cc1C2(C)C
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CC1=C(CCCO1)C(=O)Nc2ccccc2
Log Solubility:
|
<float>-2.56</float>
|
CC1=C(CCCO1)C(=O)Nc2ccccc2
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCN(=O)=O
Log Solubility:
|
<float>-0.22</float>
|
CCN(=O)=O
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCCC(C)(O)CC
Log Solubility:
|
<float>-0.98</float>
|
CCCC(C)(O)CC
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCCOC(=O)CCC
Log Solubility:
|
<float>-1.75</float>
|
CCCOC(=O)CCC
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): BrC(Br)(Br)Br
Log Solubility:
|
<float>-3.14</float>
|
BrC(Br)(Br)Br
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Brc1ccccc1
Log Solubility:
|
<float>-2.55</float>
|
Brc1ccccc1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCC1(CC)C(=O)NC(=O)N(C)C1=O
Log Solubility:
|
<float>-2.23</float>
|
CCC1(CC)C(=O)NC(=O)N(C)C1=O
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CC(C)COC(=O)C
Log Solubility:
|
<float>-1.21</float>
|
CC(C)COC(=O)C
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): O=Cc1ccco1
Log Solubility:
|
<float>-0.1</float>
|
O=Cc1ccco1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Clc1ccc(I)cc1
Log Solubility:
|
<float>-4.03</float>
|
Clc1ccc(I)cc1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Cc1ccc2cc3ccccc3cc2c1
Log Solubility:
|
<float>-6.96</float>
|
Cc1ccc2cc3ccccc3cc2c1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): c1ccc2c(c1)c3cccc4ccc5cccc2c5c43
Log Solubility:
|
<float>-7.8</float>
|
c1ccc2c(c1)c3cccc4ccc5cccc2c5c43
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCOP(=O)(OCC)OCC
Log Solubility:
|
<float>0.43</float>
|
CCOP(=O)(OCC)OCC
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): COc1ccc(Cl)cc1
Log Solubility:
|
<float>-2.78</float>
|
COc1ccc(Cl)cc1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Oc1ccc(Cl)cc1Cl
Log Solubility:
|
<float>-1.55</float>
|
Oc1ccc(Cl)cc1Cl
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): OC4=C(C1CCC(CC1)c2ccc(Cl)cc2)C(=O)c3ccccc3C4=O
Log Solubility:
|
<float>-5.931</float>
|
OC4=C(C1CCC(CC1)c2ccc(Cl)cc2)C(=O)c3ccccc3C4=O
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): NC(=S)Nc1ccccc1
Log Solubility:
|
<float>-1.77</float>
|
NC(=S)Nc1ccccc1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): O=C(Cn1ccnc1N(=O)=O)NCc2ccccc2
Log Solubility:
|
<float>-2.81</float>
|
O=C(Cn1ccnc1N(=O)=O)NCc2ccccc2
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): COc5cc4OCC3Oc2c1CC(Oc1ccc2C(=O)C3c4cc5OC)C(C)=C
Log Solubility:
|
<float>-4.42</float>
|
COc5cc4OCC3Oc2c1CC(Oc1ccc2C(=O)C3c4cc5OC)C(C)=C
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): O(c1ccccc1)c2ccccc2
Log Solubility:
|
<float>-3.96</float>
|
O(c1ccccc1)c2ccccc2
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): O=c1[nH]cnc2nc[nH]c12
Log Solubility:
|
<float>-2.296</float>
|
O=c1[nH]cnc2nc[nH]c12
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): OCCCC=C
Log Solubility:
|
<float>-0.15</float>
|
OCCCC=C
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CC(=O)C1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C
Log Solubility:
|
<float>-4.42</float>
|
CC(=O)C1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CN(C)C(=O)OC1=CC(=O)CC(C)(C)C1
Log Solubility:
|
<float>-0.85</float>
|
CN(C)C(=O)OC1=CC(=O)CC(C)(C)C1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Oc1ccc2ccccc2c1
Log Solubility:
|
<float>-2.28</float>
|
Oc1ccc2ccccc2c1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCNc1nc(NC(C)(C)C)nc(SC)n1
Log Solubility:
|
<float>-4.0</float>
|
CCNc1nc(NC(C)(C)C)nc(SC)n1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Clc1cccc(Cl)c1c2c(Cl)cccc2Cl
Log Solubility:
|
<float>-7.39</float>
|
Clc1cccc(Cl)c1c2c(Cl)cccc2Cl
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CN2C(=C(O)c1ccccc1S2(=O)=O)C(=O)Nc3ccccn3
Log Solubility:
|
<float>-4.16</float>
|
CN2C(=C(O)c1ccccc1S2(=O)=O)C(=O)Nc3ccccn3
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Oc2ncc1nccnc1n2
Log Solubility:
|
<float>-1.947</float>
|
Oc2ncc1nccnc1n2
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CC(C#C)N(C)C(=O)Nc1ccc(Cl)cc1
Log Solubility:
|
<float>-3.9</float>
|
CC(C#C)N(C)C(=O)Nc1ccc(Cl)cc1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CC1(C)C(C=C(Br)Br)C1C(=O)OC(C#N)c2cccc(Oc3ccccc3)c2
Log Solubility:
|
<float>-8.402000000000001</float>
|
CC1(C)C(C=C(Br)Br)C1C(=O)OC(C#N)c2cccc(Oc3ccccc3)c2
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CC(C)c1ccccc1C
Log Solubility:
|
<float>-3.76</float>
|
CC(C)c1ccccc1C
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Cc1ccc(O)c(C)c1
Log Solubility:
|
<float>-1.19</float>
|
Cc1ccc(O)c(C)c1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCCCCCOC(=O)c1ccccc1C(=O)OCCCCCC
Log Solubility:
|
<float>-6.144</float>
|
CCCCCCOC(=O)c1ccccc1C(=O)OCCCCCC
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CSc1nc(nc(n1)N(C)C)N(C)C
Log Solubility:
|
<float>-2.676</float>
|
CSc1nc(nc(n1)N(C)C)N(C)C
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Cc1ccccc1N(=O)=O
Log Solubility:
|
<float>-2.33</float>
|
Cc1ccccc1N(=O)=O
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCCc1ccccc1
Log Solubility:
|
<float>-3.37</float>
|
CCCc1ccccc1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CC1CC(C)C(=O)C(C1)C(O)CC2CC(=O)NC(=O)C2
Log Solubility:
|
<float>-1.13</float>
|
CC1CC(C)C(=O)C(C1)C(O)CC2CC(=O)NC(=O)C2
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCC(C)(C)CO
Log Solubility:
|
<float>-1.04</float>
|
CCC(C)(C)CO
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Oc1ccc(C=O)cc1
Log Solubility:
|
<float>-0.96</float>
|
Oc1ccc(C=O)cc1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CN(C)c1ccccc1
Log Solubility:
|
<float>-1.92</float>
|
CN(C)c1ccccc1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): ClC(Cl)C(c1ccc(Cl)cc1)c2ccc(Cl)cc2
Log Solubility:
|
<float>-7.2</float>
|
ClC(Cl)C(c1ccc(Cl)cc1)c2ccc(Cl)cc2
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Nc1cc(nc(N)n1=O)N2CCCCC2
Log Solubility:
|
<float>-1.989</float>
|
Nc1cc(nc(N)n1=O)N2CCCCC2
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): OCC(O)COC(=O)c1ccccc1Nc2ccnc3cc(Cl)ccc23
Log Solubility:
|
<float>-4.571000000000001</float>
|
OCC(O)COC(=O)c1ccccc1Nc2ccnc3cc(Cl)ccc23
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Clc1cccc(n1)C(Cl)(Cl)Cl
Log Solubility:
|
<float>-3.76</float>
|
Clc1cccc(n1)C(Cl)(Cl)Cl
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Nc3ccc2cc1ccccc1cc2c3
Log Solubility:
|
<float>-5.17</float>
|
Nc3ccc2cc1ccccc1cc2c3
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCCCI
Log Solubility:
|
<float>-2.96</float>
|
CCCCI
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Clc1ccc(Cl)c(c1)c2c(Cl)c(Cl)cc(Cl)c2Cl
Log Solubility:
|
<float>-7.42</float>
|
Clc1ccc(Cl)c(c1)c2c(Cl)c(Cl)cc(Cl)c2Cl
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCNC(=S)NCC
Log Solubility:
|
<float>-1.46</float>
|
CCNC(=S)NCC
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Cc1ccccc1Cl
Log Solubility:
|
<float>-3.52</float>
|
Cc1ccccc1Cl
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CC(C)OC(=O)Nc1cccc(Cl)c1
Log Solubility:
|
<float>-3.38</float>
|
CC(C)OC(=O)Nc1cccc(Cl)c1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCCC=C
Log Solubility:
|
<float>-2.68</float>
|
CCCC=C
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCBr
Log Solubility:
|
<float>-1.09</float>
|
CCBr
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): c1c(OC)c(OC)C2C(=O)OCC2c1
Log Solubility:
|
<float>-1.899</float>
|
c1c(OC)c(OC)C2C(=O)OCC2c1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Cc1ccc2c(ccc3ccccc32)c1
Log Solubility:
|
<float>-5.84</float>
|
Cc1ccc2c(ccc3ccccc32)c1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Clc1ccc(cc1)c2cccc(Cl)c2Cl
Log Solubility:
|
<float>-6.29</float>
|
Clc1ccc(cc1)c2cccc(Cl)c2Cl
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CNC(=O)Oc1ccccc1C2OCCO2
Log Solubility:
|
<float>-1.57</float>
|
CNC(=O)Oc1ccccc1C2OCCO2
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCCCCCCCC(=O)OC
Log Solubility:
|
<float>-3.38</float>
|
CCCCCCCCC(=O)OC
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): C(Cc1ccccc1)c2ccccc2
Log Solubility:
|
<float>-4.62</float>
|
C(Cc1ccccc1)c2ccccc2
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CC(C)c1ccccc1
Log Solubility:
|
<float>-3.27</float>
|
CC(C)c1ccccc1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Cc2ncc1nccnc1n2
Log Solubility:
|
<float>-0.12</float>
|
Cc2ncc1nccnc1n2
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Cc1cc(ccc1NS(=O)(=O)C(F)(F)F)S(=O)(=O)c2ccccc2
Log Solubility:
|
<float>-3.8</float>
|
Cc1cc(ccc1NS(=O)(=O)C(F)(F)F)S(=O)(=O)c2ccccc2
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): C=Cc1ccccc1
Log Solubility:
|
<float>-2.82</float>
|
C=Cc1ccccc1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCCCCCCO
Log Solubility:
|
<float>-1.81</float>
|
CCCCCCCO
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): Cc1ccccc1N(=O)=O
Log Solubility:
|
<float>-2.33</float>
|
Cc1ccccc1N(=O)=O
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CC1CC(C)C(=O)C(C1)C(O)CC2CC(=O)NC(=O)C2
Log Solubility:
|
<float>-1.13</float>
|
CC1CC(C)C(=O)C(C1)C(O)CC2CC(=O)NC(=O)C2
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CS(=O)(=O)c1ccc(cc1)C(O)C(CO)NC(=O)C(Cl)Cl
Log Solubility:
|
<float>-2.154</float>
|
CS(=O)(=O)c1ccc(cc1)C(O)C(CO)NC(=O)C(Cl)Cl
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CCC(C)(O)CC
Log Solubility:
|
<float>-0.36</float>
|
CCC(C)(O)CC
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): COc2c1occc1c(OC)c3c(=O)cc(C)oc23
Log Solubility:
|
<float>-3.0210000000000004</float>
|
COc2c1occc1c(OC)c3c(=O)cc(C)oc23
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): CN(C)c1ccccc1
Log Solubility:
|
<float>-1.92</float>
|
CN(C)c1ccccc1
|
scaffold
| 0
|
smiles
| |
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge.
Task Description:
Given the Smiles string and molecular properties above, predict the measured log solubility in mols per litre for this compound. Consider all molecular properties provided, especially the electronic configurations and molecular structure which influence solubility.
Target Molecule (Smiles): COC=O
Log Solubility:
|
<float>0.58</float>
|
COC=O
|
scaffold
| 0
|
smiles
|
End of preview. Expand
in Data Studio
ESOL-V-SMILES Dataset
Dataset Description
This dataset contains molecular data with visual representations for BACE (Beta-secretase 1) related compounds.
Features
- Question: Question related to the molecule
- Answer: Corresponding answer
- TargetMolecule: SMILES representation of the target molecule
- SampleMethod: Method used for sampling
- SampleNum: Sample number
- SampleRep: Sample repetition
- image: Generated molecular structure image from SMILES
Dataset Statistics
- Total samples: 220
- Image format: PIL Image (RGB)
- Image size: 300x300 pixels
Usage
from datasets import load_dataset
dataset = load_dataset("molvision/ESOL-V-SMILES-0")
Data Fields
Question(string): Question textAnswer(string): Answer textTargetMolecule(string): SMILES representationSampleMethod(string): Sampling methodSampleNum(int): Sample numberSampleRep(string): Sample repetitionimage(PIL.Image): Molecular structure visualization
Citation
Please cite this dataset if you use it in your research.
- Downloads last month
- 24